For research use only. Not for therapeutic Use.
2-Methylindole (Cat No.:R017893) is a chemical compound with the molecular formula C9H9N. It consists of an indole ring substituted with a methyl group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Indole derivatives are prevalent in natural products and pharmaceuticals, making 2-methylindole a valuable building block for creating diverse molecules. Its structural features contribute to its reactivity and its role in constructing complex structures for drug discovery and materials science applications. 2-Methylindole’s versatility supports its importance in advancing synthetic chemistry and scientific exploration.
CAS Number | 95-20-5 |
Synonyms | 2-Methyl-1H-indole; NSC 7514; 2-Methyl-1H-indole |
Molecular Formula | C9H9N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-1H-indole |
InChI | InChI=1S/C9H9N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6,10H,1H3 |
InChIKey | BHNHHSOHWZKFOX-UHFFFAOYSA-N |
SMILES | CC1=CC2=CC=CC=C2N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |