For research use only. Not for therapeutic Use.
2-Methylindoline-5-carbonitrile(CAT: L012897) is a substituted indoline derivative featuring a methyl group at the 2-position and a nitrile group at the 5-position on the indoline ring. This compound is valuable in organic synthesis and medicinal chemistry due to its indoline core, which is a common structural motif in bioactive molecules. The nitrile group allows for further functionalization, making it a useful intermediate in the development of pharmaceuticals, agrochemicals, and other biologically active compounds. 2-Methylindoline-5-carbonitrile is often employed in the synthesis of molecules for potential applications in oncology, neuroscience, and anti-infective research.
CAS Number | 267002-63-1 |
Molecular Formula | C10H10N2 |
Purity | ≥95% |
IUPAC Name | 2-methyl-2,3-dihydro-1H-indole-5-carbonitrile |
InChI | InChI=1S/C10H10N2/c1-7-4-9-5-8(6-11)2-3-10(9)12-7/h2-3,5,7,12H,4H2,1H3 |
InChIKey | ZBYZNDDDEZXVLZ-UHFFFAOYSA-N |