For research use only. Not for therapeutic Use.
2-Methyloctadecane(Cat No.:M047702) is a branched alkane with the molecular formula C19H40. It consists of an octadecane backbone—a straight chain of 18 carbon atoms—with a methyl group attached to the second carbon, giving it a slight branch. This structural feature increases its molecular complexity compared to its straight-chain counterparts, affecting its physical properties like boiling point and solubility. 2-Methyloctadecane is primarily used in the study of hydrocarbon behavior and properties in different environments and can serve as a component in specialized lubricants and fuels due to its stable hydrophobic nature.
CAS Number | 1560-88-9 |
Molecular Formula | C19H40 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyloctadecane |
InChI | InChI=1S/C19H40/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h19H,4-18H2,1-3H3 |
InChIKey | KVQVGSDBGJXNGV-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCC(C)C |