For research use only. Not for therapeutic Use.
2-Methylphenethyl alcohol（Cat No.:M004041）is an aromatic alcohol characterized by a methyl group at the 2-position and a hydroxyl group attached to the ethyl side chain. This compound is widely used in the fragrance and flavor industries due to its pleasant floral scent, often contributing to the composition of perfumes and cosmetic products. Additionally, it serves as an intermediate in organic synthesis for pharmaceuticals and fine chemicals. 2-Methylphenethyl alcohol is valued for its stability and versatility, making it essential for both industrial applications and research in synthetic chemistry.
| Catalog Number | M004041 |
| CAS Number | 19819-98-8 |
| Molecular Formula | C9H12O |
| Purity | ≥95% |
| IUPAC Name | 2-(2-methylphenyl)ethanol |
| InChI | InChI=1S/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | RUGISKODRCWQNE-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CCO |
