For research use only. Not for therapeutic Use.
2-methylphenylacetylene(Cat No.:L006909), also known as 2-polyacetylene or o-polyacetylene, is an organic compound with the chemical formula C9H8. It is a colorless liquid with a sweet odor, commonly used in chemical synthesis and research applications. This compound is characterized by a phenyl group (C6H5) attached to a carbon-carbon triple bond, making it an alkyne. 2-Methylphenylacetylene serves as a valuable building block in the production of various chemicals and pharmaceuticals, owing to its reactive nature and versatility in organic synthesis.
CAS Number | 766-47-2 |
Molecular Formula | C9H8 |
Purity | ≥95% |
IUPAC Name | 1-ethynyl-2-methylbenzene |
InChI | InChI=1S/C9H8/c1-3-9-7-5-4-6-8(9)2/h1,4-7H,2H3 |
InChIKey | MYBSUWNEMXUTAX-UHFFFAOYSA-N |
SMILES | CC1=CC=CC=C1C#C |