For research use only. Not for therapeutic Use.
2-Methylpropane-d10(Cat No.:M084035)is a high-purity, fully deuterated compound essential for advanced pharmaceutical and chemical research. This isotopically labeled version of 2-Methylpropane, featuring ten deuterium atoms, is crucial for studies involving molecular dynamics, NMR spectroscopy, and reaction mechanisms. The incorporation of stable isotopes ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for diverse research applications, 2-Methylpropane-d10 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations and the development of innovative chemical processes.
CAS Number | 19170-96-8 |
Molecular Formula | C4H10 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 1,1,1,2,3,3,3-heptadeuterio-2-(trideuteriomethyl)propane |
InChI | InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3/i1D3,2D3,3D3,4D |
InChIKey | NNPPMTNAJDCUHE-LSURFNHSSA-N |
SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |