For research use only. Not for therapeutic Use.
2-Methylpyrazolo[1,5-a]pyrazin-4(5H)-one(CAT: L019018) is a heterocyclic compound with significant applications in pharmaceutical and synthetic chemistry. Its fused pyrazolo-pyrazine structure, enhanced by a methyl group at the 2-position, provides unique reactivity and versatility for the design of bioactive molecules and advanced materials. The 4(5H)-one functional group further enhances its chemical properties, making it an essential intermediate in drug discovery and the development of agrochemicals. 2-Methylpyrazolo[1,5-a]pyrazin-4(5H)-one offers consistent performance, stability, and adaptability, supporting innovative applications in medicinal chemistry and synthetic research pathways.
CAS Number | 1314920-48-3 |
Molecular Formula | C7H7N3O |
Purity | ≥95% |
IUPAC Name | 2-methyl-5H-pyrazolo[1,5-a]pyrazin-4-one |
InChI | InChI=1S/C7H7N3O/c1-5-4-6-7(11)8-2-3-10(6)9-5/h2-4H,1H3,(H,8,11) |
InChIKey | NAKXMKJPCVPIOB-UHFFFAOYSA-N |
SMILES | CC1=NN2C=CNC(=O)C2=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |