2-Methylresorcinol(Cat No.:R070728)is an organic compound and a derivative of resorcinol, featuring a methyl group at the 2-position of the benzene ring. It is widely used in the cosmetic and hair dye industry due to its ability to produce vibrant, long-lasting colors when oxidized. Beyond its cosmetic applications, 2-Methylresorcinol is also utilized in chemical synthesis as an intermediate for producing pharmaceuticals, agrochemicals, and other fine chemicals. Its unique properties, such as its reactivity and stability, make it a versatile compound in various industrial and research applications.
Catalog Number | R070728 |
CAS Number | 608-25-3 |
Molecular Formula | C7H8O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-methylbenzene-1,3-diol |
InChI | InChI=1S/C7H8O2/c1-5-6(8)3-2-4-7(5)9/h2-4,8-9H,1H3 |
InChIKey | ZTMADXFOCUXMJE-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1O)O |