For research use only. Not for therapeutic Use.
2-Methylthiazole-5-carbaldehyde is a sulfur- and nitrogen-containing heterocyclic compound, widely utilized in pharmaceutical and flavor chemistry. With a methyl group and aldehyde functionality on a thiazole ring, it serves as a key intermediate in synthesizing bioactive compounds, including those with antimicrobial, anti-inflammatory, and flavor-enhancing properties. Its reactive aldehyde group allows for versatile chemical modifications, making it valuable in drug discovery and organic synthesis. This compound’s stability and reactivity make it an essential building block in various research applications.
CAS Number | 1003-60-7 |
Molecular Formula | C5H5NOS |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-methyl-1,3-thiazole-5-carbaldehyde |
InChI | InChI=1S/C5H5NOS/c1-4-6-2-5(3-7)8-4/h2-3H,1H3 |
InChIKey | YELBTTSDCRQQRE-UHFFFAOYSA-N |
SMILES | CC1=NC=C(S1)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |