For research use only. Not for therapeutic Use.
2-Morpholino-6-nitrooxazolo[4,5-b]pyridine (Cat.No:L003896) is a significant chemical compound in pharmaceutical research. Its distinctive fused-ring structure, containing a nitrooxazole and morpholino group, imparts unique reactivity. This compound is a valuable scaffold for the development of potential drug candidates, particularly in the field of medicinal chemistry.
Catalog Number | L003896 |
CAS Number | 931321-16-3 |
Molecular Formula | C10H10N4O4 |
Purity | ≥95% |
IUPAC Name | 2-morpholin-4-yl-6-nitro-[1,3]oxazolo[4,5-b]pyridine |
InChI | InChI=1S/C10H10N4O4/c15-14(16)7-5-8-9(11-6-7)12-10(18-8)13-1-3-17-4-2-13/h5-6H,1-4H2 |
InChIKey | FEOCYZPSLBWRFB-UHFFFAOYSA-N |
SMILES | C1COCCN1C2=NC3=C(O2)C=C(C=N3)[N+](=O)[O-] |