For research use only. Not for therapeutic Use.
2-[N-(9-Fluorenylmethoxycarbonyl)-N-decylamino]ethanal is a specialized organic compound featuring a unique combination of a fluorene-derived protective group and a decylamino chain attached to an ethanal moiety. This structure makes it valuable in peptide synthesis, particularly in the development of protected amino acids and derivatives. The fluorene group offers stability during chemical reactions, facilitating the synthesis of complex biomolecules. Researchers utilize this compound in medicinal chemistry to create targeted therapeutics and investigate its potential applications in drug design and development.
CAS Number | 239088-22-3 |
Synonyms | N-Decyl-N-(2-oxoethyl)-9H-fluoren-9-ylmethyl Ester; Decyl(2-oxoethyl)-carbamic Acid 9H-Fluoren-9-ylmethyl Ester |
Molecular Formula | C27H35NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9H-fluoren-9-ylmethyl N-decyl-N-(2-oxoethyl)carbamate |
InChI | InChI=1S/C27H35NO3/c1-2-3-4-5-6-7-8-13-18-28(19-20-29)27(30)31-21-26-24-16-11-9-14-22(24)23-15-10-12-17-25(23)26/h9-12,14-17,20,26H,2-8,13,18-19,21H2,1H3 |
InChIKey | AWGULBUAOMFSCY-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCN(CC=O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |