For research use only. Not for therapeutic Use.
2-Naphthalenebutanoic acid is an organic compound featuring a naphthalene ring connected to a butanoic acid moiety. Its chemical formula is C₁₁H₁₂O₂. This compound is of interest in medicinal chemistry and agrochemicals due to its potential biological activities, including anti-inflammatory properties. The naphthalene structure contributes to its lipophilicity, enhancing its ability to interact with biological targets. Additionally, 2-naphthalenebutanoic acid serves as a valuable building block in synthetic organic chemistry for the development of various pharmaceuticals and chemical intermediates.
| Catalog Number | R031011 |
| CAS Number | 782-28-5 |
| Synonyms | 4-(2-Naphthyl)butanoic Acid; 4-(2-Naphthyl)butyric Acid; 4-(Naphthalen-2-yl)butanoic Acid; NSC 3036; γ-(2-Naphthyl)butyric Acid; 2-Naphthalenebutyric Acid |
| Molecular Formula | C14H14O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-naphthalen-2-ylbutanoic acid |
| InChI | InChI=1S/C14H14O2/c15-14(16)7-3-4-11-8-9-12-5-1-2-6-13(12)10-11/h1-2,5-6,8-10H,3-4,7H2,(H,15,16) |
| InChIKey | HBRVUQIGDLSBCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CCCC(=O)O |
