2-Naphthalenesulfinic Acid Sodium Salt（Cat No.:L007446）, is a chemical compound with the molecular formula C₁₀H₇NaO₂S. This compound contains a naphthalene ring with a sulfinic acid functional group (-SO₂H) attached at the 2-position, and it is in the form of a sodium salt, indicating the presence of a sodium cation (Na⁺). Sodium salts of organic compounds are widely used in various chemical processes and as intermediates in the synthesis of pharmaceuticals and agrochemicals. The sulfinic acid group in this compound imparts unique reactivity, making it valuable in different chemical applications.
| Catalog Number | L007446 |
| CAS Number | 63735-42-2 |
| Molecular Formula | C10H7NaO2S |
| Purity | ≥95% |
| IUPAC Name | sodium;naphthalene-2-sulfinate |
| InChI | InChI=1S/C10H8O2S.Na/c11-13(12)10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,(H,11,12);/q;+1/p-1 |
| InChIKey | JGGFVSGYTHUAOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)[O-].[Na+] |
