For research use only. Not for therapeutic Use.
<p>
2-Naphthylamine (CAS 91-59-8) <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> is a naphthylamine </span><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">carrying the amino</span><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> group at position 2. It has a role as a carcinogenic agent. </span><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">It is a colorless solid, but samples take on a reddish color in air because of oxidation. It was formerly used to make azo dyes, but it is a known carcinogen and has largely been replaced by less toxic compounds.</span></span></span></p>
CAS Number | 91-59-8 |
Synonyms | 2-Aminonaphthalene; β-Naphthylamine; 2-Naphthalenamine; |
Molecular Formula | C10H9N |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | naphthalen-2-amine |
InChI | InChI=1S/C10H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,11H2 |
InChIKey | JBIJLHTVPXGSAM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C(C=CC2=C1)N |
Reference | <p> |