For research use only. Not for therapeutic Use.
2-Nitro-1,3-benzenedimethanol(Cat No.:R032192)is an organic compound featuring a nitro group and two hydroxymethyl groups attached to a benzene ring. This compound is used in synthetic chemistry as a versatile intermediate for creating various pharmaceuticals, agrochemicals, and dyes. Its structure allows for multiple functional group modifications, making it valuable for developing new chemical entities. Additionally, 2-Nitro-1,3-benzenedimethanol is employed in material science for creating advanced polymers and resins, highlighting its broad utility in both research and industrial applications.
CAS Number | 16578-60-2 |
Synonyms | 2-Nitro-m-Xylene-α,α’-diol; |
Molecular Formula | C8H9NO4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | [3-(hydroxymethyl)-2-nitrophenyl]methanol |
InChI | InChI=1S/C8H9NO4/c10-4-6-2-1-3-7(5-11)8(6)9(12)13/h1-3,10-11H,4-5H2 |
InChIKey | KZYWBYBQPIOWIY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)CO)[N+](=O)[O-])CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |