For research use only. Not for therapeutic Use.
2-Nitro-1H-pyrrole(Cat No.:L042946)is a nitro-substituted heterocyclic compound featuring a nitro group at the 2-position on a pyrrole ring. This compound is widely used in pharmaceutical research and organic synthesis as a key intermediate for the development of bioactive molecules, including potential drug candidates and agrochemicals. The nitro group enhances the compound’s reactivity, allowing for diverse chemical transformations, such as reductions and nucleophilic substitutions. Its structure makes it particularly useful in constructing complex molecular frameworks, with high purity ensuring reliable performance in advanced research and chemical development.
CAS Number | 5919-26-6 |
Molecular Formula | C4H4N2O2 |
Purity | ≥95% |
IUPAC Name | 2-nitro-1H-pyrrole |
InChI | InChI=1S/C4H4N2O2/c7-6(8)4-2-1-3-5-4/h1-3,5H |
InChIKey | FTBBGQKRYUTLMP-UHFFFAOYSA-N |
SMILES | C1=CNC(=C1)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |