For research use only. Not for therapeutic Use.
2-Nitro-4-(trifluoromethylthio)aniline(Cat No.:L006798). It features an aniline ring substituted with a nitro group at the 2-position and a trifluoromethylthio (-SCF3) group at the 4-position. This compound is valuable in organic synthesis, particularly in the creation of complex organic molecules. Its unique structure enables diverse chemical transformations, making it useful in the synthesis of various organic compounds, including dyes, pigments, and pharmaceutical intermediates. Researchers employ it as a versatile building block, contributing to advancements in drug discovery, materials science, and the production of specialty chemicals.
CAS Number | 404-74-0 |
Molecular Formula | C7H5F3N2O2S |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-nitro-4-(trifluoromethylsulfanyl)aniline |
InChI | InChI=1S/C7H5F3N2O2S/c8-7(9,10)15-4-1-2-5(11)6(3-4)12(13)14/h1-3H,11H2 |
InChIKey | KRTQZQWXBLOTSY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1SC(F)(F)F)[N+](=O)[O-])N |