For research use only. Not for therapeutic Use.
2-Nitrobenzaldehyde-d4 is a deuterated analog of 2-nitrobenzaldehyde, with four deuterium atoms incorporated into its molecular structure. This high-purity isotopically labeled compound is crucial for research in organic chemistry, photochemistry, and materials science. It is particularly valuable for studying reaction mechanisms, photochemical processes, and synthetic pathways involving nitrobenzaldehydes. The deuterium labeling enables precise tracking and quantification in analytical techniques such as mass spectrometry, providing enhanced accuracy in complex reaction environments. 2-Nitrobenzaldehyde-d4 is an essential tool for researchers focusing on the development of novel materials, photoreactive compounds, and the exploration of chemical transformations.
CAS Number | 1020718-69-7 |
Synonyms | 1-Formyl-2-nitrobenzene-d4; 2-Formyl-3-nitrobenzene-d4; NSC 5713-d4;?2-NBA-d4 |
Molecular Formula | C7H5NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,4,5-tetradeuterio-6-nitrobenzaldehyde |
InChI | InChI=1S/C7H5NO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5H/i1D,2D,3D,4D |
InChIKey | CMWKITSNTDAEDT-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C=O)[N+](=O)[O-])[2H])[2H] |