For research use only. Not for therapeutic Use.
2-Nitrobenzimidazole（Cat No.:L033904）is a key compound in pharmaceutical and chemical research, known for its role in the synthesis of bioactive molecules, particularly in the development of antimicrobial and anticancer agents. This nitro-substituted benzimidazole is valuable for creating heterocyclic compounds with potential therapeutic applications. Its structure, combining a benzimidazole core with a nitro group, allows for diverse chemical modifications, making it essential in medicinal chemistry and drug discovery. With high purity and stability, 2-Nitrobenzimidazole supports precise synthetic transformations, contributing to advanced research in developing new drugs and therapeutic agents.
| Catalog Number | L033904 |
| CAS Number | 5709-67-1 |
| Molecular Formula | C7H5N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-nitro-1H-benzimidazole |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,9) |
| InChIKey | KRTDQDCPEZRVGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)[N+](=O)[O-] |
