For research use only. Not for therapeutic Use.
2-Nitrobiphenyl-2’,3’,4’,5’,6’-d5(Cat No.:R003061) is a high-purity deuterated compound essential for advanced pharmaceutical and chemical research. This isotopically labeled version of 2-Nitrobiphenyl features five deuterium atoms, enhancing its stability and precision in analytical applications. It is crucial for studies involving environmental analysis, toxicology, and organic synthesis. The stable isotope labeling ensures accurate and reliable results, making it ideal for various experimental setups. Perfect for chemical synthesis and environmental research, 2-Nitrobiphenyl-2’,3’,4’,5’,6’-d5 integrates seamlessly into existing protocols, providing a robust solution for high-precision scientific investigations.
CAS Number | 64420-97-9 |
Synonyms | o-Nitrodiphenyl-d5; 2-Phenylnitrobenzene-d5; NSC 5532-d5; |
Molecular Formula | C12H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(2-nitrophenyl)benzene |
InChI | InChI=1S/C12H9NO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H/i1D,2D,3D,6D,7D |
InChIKey | YOJKKXRJMXIKSR-FSTBWYLISA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=CC=C2[N+](=O)[O-])[2H])[2H] |