For research use only. Not for therapeutic Use.
2-Nitrofuran is a nitro-substituted furan derivative known for its diverse applications in organic synthesis and pharmaceuticals. This compound exhibits potential antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. Its unique structure allows for various chemical transformations, facilitating the development of new bioactive molecules. Additionally, 2-Nitrofuran serves as a valuable intermediate in the synthesis of more complex compounds. Ongoing research aims to explore its biological activities further and assess its efficacy in therapeutic applications.
| CAS Number | 609-39-2 |
| Synonyms | NSC 59983; Nitrofuran; |
| Molecular Formula | C4H3NO3 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 2-nitrofuran |
| InChI | InChI=1S/C4H3NO3/c6-5(7)4-2-1-3-8-4/h1-3H |
| InChIKey | FUBFWTUFPGFHOJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)[N+](=O)[O-] |
