For research use only. Not for therapeutic Use.
2′-O-methyl-5-methyluridine(Cat No.:L015373), is a modified nucleoside used in RNA research and organic synthesis. It is a ribonucleoside derivative with a methyl group at the 2′-position and an additional methyl group at the 5-position of the uridine base. This modification enhances RNA stability and influences RNA-protein interactions. It serves as a valuable building block for creating modified RNA sequences with specific properties, making it essential for studying RNA structure, function, and gene expression regulation.
CAS Number | 55486-09-4 |
Molecular Formula | C11H16N2O6 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | 2-8°C |
IUPAC Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
InChI | InChI=1S/C11H16N2O6/c1-5-3-13(11(17)12-9(5)16)10-8(18-2)7(15)6(4-14)19-10/h3,6-8,10,14-15H,4H2,1-2H3,(H,12,16,17)/t6-,7-,8-,10-/m1/s1 |
InChIKey | YHRRPHCORALGKQ-FDDDBJFASA-N |
SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)OC |