For research use only. Not for therapeutic Use.
2’-O-Methyl Cytidine(Cat No.:R012660)is a high-purity modified nucleoside widely used in biochemical and pharmaceutical research. Featuring a methyl group on the 2’-hydroxyl position of the ribose sugar, it enhances RNA stability and reduces immune recognition, making it valuable in RNA-based therapeutics and vaccine development. This compound is instrumental in studying RNA modifications, nucleoside metabolism, and gene regulation. Its role in optimizing mRNA design for improved translational efficiency and reduced immunogenicity highlights its importance in advancing RNA research and developing innovative therapeutics. Its purity ensures consistent and reliable experimental outcomes.
CAS Number | 2140-72-9 |
Synonyms | O2’-Methylcytidine; |
Molecular Formula | C10H15N3O5 |
Purity | ≥95% |
Target | HCV |
Storage | -20°C |
IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C10H15N3O5/c1-17-8-7(15)5(4-14)18-9(8)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,9-/m1/s1 |
InChIKey | RFCQJGFZUQFYRF-ZOQUXTDFSA-N |
SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)O |