For research use only. Not for therapeutic Use.
N2-Isobutyryl-2′-O-methyl-guanosine (Cat No.: R012659) is a modified nucleoside derivative of guanosine, where the isobutyryl group is attached at the N2 position of the purine base, and the 2′-OH group of the ribose is methylated. This modification can influence the nucleoside’s stability, interactions with other molecules, and its role in RNA and DNA processes. Such modifications are often studied for their potential impact on gene expression regulation, RNA structure, and their use in therapeutic applications like antisense oligonucleotides.
CAS Number | 2140-71-8 |
Synonyms | O2′-Methylguanosine; |
Molecular Formula | C11H15N5O5 |
Purity | 95% |
Target | Cell Cycle/DNA Damage |
Appearance | A crystalline solid |
Storage | -20°C |
IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3H-purin-6-one |
InChI | InChI=1S/C11H15N5O5/c1-20-7-6(18)4(2-17)21-10(7)16-3-13-5-8(16)14-11(12)15-9(5)19/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 |
InChIKey | OVYNGSFVYRPRCG-KQYNXXCUSA-N |
SMILES | COC1C(C(OC1N2C=NC3=C2NC(=NC3=O)N)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |