For research use only, not for therapeutic use.
2-Octyldodecane-1-ol(CAT: R017639) is a high-purity long-chain alcohol commonly used in cosmetic and personal care products. This versatile compound acts as an emollient, providing a smooth and silky texture to formulations while enhancing the hydration and moisture retention properties of the skin. Its stability and non-greasy feel make it ideal for use in creams, lotions, and hair care products. Additionally, 2-Octyldodecane-1-ol serves as a key intermediate in the synthesis of various chemical compounds, making it valuable in both industrial and pharmaceutical applications. Its consistency and effectiveness ensure optimal performance across a range of products.
| Catalog Number | R017639 |
| CAS Number | 5333-42-6 |
| Synonyms | 2-Octyldodecanol; 2-Octyldodecyl alcohol; Eutanol G; Eutanol G-PH; Exxal 20; Fine Oxocol 2000; Guerbet C20; Isofol 20; Jarcol I 20; Kalcohl 200G; Kalcohl 200GD; Kollicream OD; NJCOL 200A; NSC 2405; OHV 180; Rilanit G 20; Risonol 20SP; 2-Octyl-1-dodec |
| Molecular Formula | C20H42O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-octyldodecan-1-ol |
| InChI | InChI=1S/C20H42O/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey | LEACJMVNYZDSKR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCC(CCCCCCCC)CO |
