For research use only. Not for therapeutic Use.
2-Oxa-6-azaspiro[3.3]heptane is a bicyclic compound featuring an oxirane and azaspiro structure, which contributes to its unique chemical properties. This compound is of interest in organic synthesis and medicinal chemistry, as it can serve as a scaffold for developing various bioactive molecules. Its distinctive structure may enhance interactions with biological targets, making it valuable in drug discovery efforts. Researchers explore its potential applications in the synthesis of novel therapeutics, particularly in areas such as neurochemistry and cancer research.
CAS Number | 174-78-7 |
Molecular Formula | C5H9NO |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 2-oxa-6-azaspiro[3.3]heptane |
InChI | InChI=1S/C5H9NO/c1-5(2-6-1)3-7-4-5/h6H,1-4H2 |
InChIKey | HPJALMWOZYIZGE-UHFFFAOYSA-N |
SMILES | C1C2(CN1)COC2 |