For research use only. Not for therapeutic Use.
2-(Oxan-4-yl)acetic Acid is an organic compound featuring an oxane (tetrahydropyran) ring attached to an acetic acid moiety. It is commonly used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and bioactive molecules. The compound’s structure, with the oxane ring contributing to its stability and reactivity, makes it valuable for constructing complex chemical scaffolds. Researchers employ 2-(Oxan-4-yl)acetic Acid in the development of therapeutic agents, exploring its potential in drug discovery and the synthesis of compounds that target specific biochemical pathways in various therapeutic areas.
CAS Number | 85064-61-5 |
Molecular Formula | C7H12O3 |
Purity | ≥95% |
IUPAC Name | 2-(oxan-4-yl)acetic acid |
InChI | InChI=1S/C7H12O3/c8-7(9)5-6-1-3-10-4-2-6/h6H,1-5H2,(H,8,9) |
InChIKey | PBXYNWPYMVWJAH-UHFFFAOYSA-N |
SMILES | C1COCCC1CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |