For research use only. Not for therapeutic Use.
2-Oxo-2-(pyridin-3-yl)acetic acid is an α-keto acid featuring a pyridine ring at the 3-position and a carboxylic acid functional group. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate in the development of various bioactive molecules. The presence of the pyridine ring contributes to potential biological activities, including antimicrobial and antitumor properties. Its unique structure allows for diverse chemical transformations, making it valuable in the synthesis of pharmaceuticals and in chemical research applications.
CAS Number | 39684-37-2 |
Molecular Formula | C7H5NO3 |
Purity | ≥95% |
IUPAC Name | 2-oxo-2-pyridin-3-ylacetic acid |
InChI | InChI=1S/C7H5NO3/c9-6(7(10)11)5-2-1-3-8-4-5/h1-4H,(H,10,11) |
InChIKey | JVSRKIHKRQXLHU-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(=O)C(=O)O |