For research use only. Not for therapeutic Use.
2-oxo-2,3-Dihydrobenzooxazole-5-boronic acid(Cat No.:L007574), is a chemical compound with a unique structure that includes a benzooxazole ring, a boronic acid group, and a ketone functional group. This compound is valuable in organic synthesis and medicinal chemistry due to its potential applications in the development of pharmaceuticals and agrochemicals. Boronic acids are crucial components in Suzuki-Miyaura cross-coupling reactions, a fundamental method in organic synthesis. Researchers employ this compound as a versatile building block, enabling the creation of diverse molecules for drug discovery.
CAS Number | 710348-42-8 |
Molecular Formula | C7H6BNO4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2-oxo-3H-1,3-benzoxazol-5-yl)boronic acid |
InChI | InChI=1S/C7H6BNO4/c10-7-9-5-3-4(8(11)12)1-2-6(5)13-7/h1-3,11-12H,(H,9,10) |
InChIKey | WWGUKCACGZLIHO-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(C=C1)OC(=O)N2)(O)O |