For research use only. Not for therapeutic Use.
2-Oxo-cyclobutane Undecanoic Acid (Cat No.:R008225) is a chemical compound belonging to the cyclobutane derivative class. Also known as 2-cyclobutylideneundecanoic acid, it has potential applications in organic synthesis and medicinal chemistry. However, there is limited information available regarding its specific uses and properties. Further research is needed to explore its potential uses, mechanisms of action, and properties in various fields.
CAS Number | 169263-77-8 |
Molecular Formula | C₁₅H₂₆O₃ |
Purity | ≥95% |
Storage | 2°C to 8°C |
IUPAC Name | 11-(2-oxocyclobutyl)undecanoic acid |
InChI | InChI=1S/C15H26O3/c16-14-12-11-13(14)9-7-5-3-1-2-4-6-8-10-15(17)18/h13H,1-12H2,(H,17,18) |
InChIKey | XFBXXTOEKUXMOY-UHFFFAOYSA-N |
SMILES | C1CC(=O)C1CCCCCCCCCCC(=O)O |