For research use only. Not for therapeutic Use.
2-Oxobutanedioic acid(Cat No.:M067850), also known as oxoglutaric acid or α-ketoglutaric acid, is a key intermediate in cellular metabolism. It plays a crucial role in the citric acid cycle, also known as the Krebs cycle, where it participates in the oxidation of carbohydrates, fats, and proteins to generate energy in the form of ATP. Additionally, oxoglutaric acid serves as a precursor for the synthesis of the amino acids glutamate and glutamine, as well as other important metabolites. Its involvement in diverse metabolic pathways makes it essential for cellular function and energy production in organisms ranging from bacteria to humans.
CAS Number | 149-63-3 |
Synonyms | 2-OXOBUTANEDIOIC ACID |
Molecular Formula | C4H2O5-2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-oxobutanedioate |
InChI | InChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)/p-2 |
InChIKey | KHPXUQMNIQBQEV-UHFFFAOYSA-L |
SMILES | C(C(=O)C(=O)[O-])C(=O)[O-] |