For research use only. Not for therapeutic Use.
2-Oxopyrrolidine-1-carbaldehyde (Cat.No:L003406) is a crucial compound in organic synthesis. Its versatile reactivity and structural significance have led to its widespread application in the preparation of various functional materials and pharmaceutical intermediates. This compound plays a pivotal role in contemporary chemical research, exemplifying its importance in the advancement of diverse industries, from pharmaceuticals to materials science.
Catalog Number | L003406 |
CAS Number | 40321-44-6 |
Molecular Formula | C5H7NO2 |
Purity | ≥95% |
IUPAC Name | 2-oxopyrrolidine-1-carbaldehyde |
InChI | InChI=1S/C5H7NO2/c7-4-6-3-1-2-5(6)8/h4H,1-3H2 |
InChIKey | XALHICXNSREUAV-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1)C=O |