For research use only. Not for therapeutic Use.
2-(Perfluorooctyl)ethyl isocyanate(Cat No.:M102917) is an organic compound characterized by a perfluorooctyl group bonded to an ethyl group, which is then linked to an isocyanate group. The perfluorooctyl chain consists of eight carbon atoms where all hydrogen atoms are replaced by fluorine atoms, making it highly hydrophobic and chemically resistant. The ethyl group serves as a spacer between this highly fluorinated tail and the reactive isocyanate group. Isocyanate groups are known for their reactivity with amines, alcohols, and water, forming ureas, urethanes, and carbamic acids, respectively. This compound is used in specialized chemical syntheses and coatings.
CAS Number | 142010-50-2 |
Molecular Formula | C11H4F17NO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-isocyanatodecane |
InChI | InChI=1S/C11H4F17NO/c12-4(13,1-2-29-3-30)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-2H2 |
InChIKey | XBIIIDIAZYSZBI-UHFFFAOYSA-N |
SMILES | C(CN=C=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |