For research use only. Not for therapeutic Use.
2-Phenoxyacetohydrazide(Cat No.:L015618)is a high-purity organic compound widely used in pharmaceutical and chemical research. This molecule features a phenoxy group attached to an acetohydrazide backbone, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, particularly in the formation of hydrazones and related derivatives. 2-Phenoxyacetohydrazide is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 4664-55-5 |
Molecular Formula | C8H10N2O2 |
Purity | ≥95% |
IUPAC Name | 2-phenoxyacetohydrazide |
InChI | InChI=1S/C8H10N2O2/c9-10-8(11)6-12-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
InChIKey | XSONSBDQIFBIOY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OCC(=O)NN |