For research use only. Not for therapeutic Use.
2-Phenoxybenzenesulfonyl chloride(Cat No.:L026997)is a high-purity aromatic sulfonyl chloride widely used in pharmaceutical and chemical research. This compound features a phenoxy group attached to a benzenesulfonyl chloride moiety, making it a valuable intermediate in the synthesis of sulfonamides, sulfonate esters, and other bioactive molecules. Its reactive sulfonyl chloride group allows for selective reactivity in various chemical transformations, such as acylation and chlorosulfonation. 2-Phenoxybenzenesulfonyl chloride is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 2688-85-9 |
Molecular Formula | C12H9ClO3S |
Purity | ≥95% |
IUPAC Name | 2-phenoxybenzenesulfonyl chloride |
InChI | InChI=1S/C12H9ClO3S/c13-17(14,15)12-9-5-4-8-11(12)16-10-6-2-1-3-7-10/h1-9H |
InChIKey | MFBATEXBHGBONO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2S(=O)(=O)Cl |