For research use only. Not for therapeutic Use.
2-Phenoxyethyl-d4 alcohol(Cat No.:M031865) is a deuterated derivative of 2-phenoxyethanol, where deuterium atoms replace some of the hydrogen atoms, specifically the four hydrogens on the ethyl group, enhancing its stability and altering its physical properties. This compound is used extensively in nuclear magnetic resonance (NMR) spectroscopy as a solvent or internal standard due to the deuteration, which provides clearer and more distinct NMR signals. The phenoxyethyl structure makes it a versatile solvent in chemical synthesis and analysis, especially useful in studies requiring a detailed understanding of reaction mechanisms or complex molecular environments.
Catalog Number | M031865 |
CAS Number | 1219804-65-5 |
Synonyms | 2-Phenoxyethyl–d4 Alcohol |
Molecular Formula | C8H10O2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 1,1,2,2-tetradeuterio-2-phenoxyethanol |
InChI | InChI=1S/C8H10O2/c9-6-7-10-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i6D2,7D2 |
InChIKey | QCDWFXQBSFUVSP-KXGHAPEVSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=CC=C1)O |