For research use only. Not for therapeutic Use.
2-Phenyl-1-(thiophen-3-yl)butan-1-one (Cat.No:L004159) is a significant compound in organic synthesis. Its distinct structure, combining a phenyl and thiophene moiety, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with potential applications in pharmaceutical and chemical research.
CAS Number | 1597209-11-4 |
Molecular Formula | C14H14OS |
Purity | ≥95% |
IUPAC Name | 2-phenyl-1-thiophen-3-ylbutan-1-one |
InChI | InChI=1S/C14H14OS/c1-2-13(11-6-4-3-5-7-11)14(15)12-8-9-16-10-12/h3-10,13H,2H2,1H3 |
InChIKey | QRLDBBYKEFNMQP-UHFFFAOYSA-N |
SMILES | CCC(C1=CC=CC=C1)C(=O)C2=CSC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |