For research use only. Not for therapeutic Use.
2-Phenyl-furan is an aromatic compound characterized by a furan ring substituted with a phenyl group at the 2-position. This structure imparts unique electronic properties and reactivity, making it valuable in organic synthesis and medicinal chemistry. It serves as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals, often explored for its potential biological activities, including antimicrobial and anti-inflammatory effects. Additionally, 2-phenyl-furan is used in the development of functionalized materials and as a building block for complex organic compounds.
CAS Number | 17113-33-6 |
Synonyms | 2-PHENYL-FURAN |
Molecular Formula | C10H8O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-phenylfuran |
InChI | InChI=1S/C10H8O/c1-2-5-9(6-3-1)10-7-4-8-11-10/h1-8H |
InChIKey | GCXNJAXHHFZVIM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=CO2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |