For research use only. Not for therapeutic Use.
2-[(Phenylamino)methyl]aniline(Cat No.:L007391), is a compound of interest in the field of organic chemistry. Its molecular structure includes both an aniline and a phenylamine group, making it versatile for various chemical reactions and synthetic pathways. The compound’s properties and reactivity make it valuable in the development of dyes, pigments, and other organic materials. Researchers utilize its structure as a building block for the synthesis of more complex molecules and polymers.
Catalog Number | L007391 |
CAS Number | 20887-06-3 |
Molecular Formula | C13H14N2 |
Purity | ≥95% |
IUPAC Name | 2-(anilinomethyl)aniline |
InChI | InChI=1S/C13H14N2/c14-13-9-5-4-6-11(13)10-15-12-7-2-1-3-8-12/h1-9,15H,10,14H2 |
InChIKey | KGJUAWKSBSUKCA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NCC2=CC=CC=C2N |