For research use only. Not for therapeutic Use.
2-Phenylethyl hexanoate(CAT: L000014) is an important compound with applications primarily in the field of organic chemistry. This chemical is widely employed as a flavor and fragrance ingredient, contributing to the creation of unique scents and tastes. Its action method involves imparting a sweet, fruity, and floral aroma and flavor, making it valuable in the formulation of various consumer products, including perfumes, cosmetics, and food items. In the realm of organic chemistry, its significance lies in its role as a key compound for creating fragrances and flavors, showcasing its adaptability in this specific field.
| Catalog Number | L000014 |
| CAS Number | 6290-37-5 |
| Molecular Formula | C14H20O2 |
| Purity | ≥95% |
| IUPAC Name | 2-phenylethyl hexanoate |
| InChI | InChI=1S/C14H20O2/c1-2-3-5-10-14(15)16-12-11-13-8-6-4-7-9-13/h4,6-9H,2-3,5,10-12H2,1H3 |
| InChIKey | BUYNWUMUDHPPDS-UHFFFAOYSA-N |
