For research use only. Not for therapeutic Use.
2-Phenylhistamine dihydrochloride(Cat No.:L007724), is a chemical compound used in the field of pharmacology. It is a histamine receptor agonist, specifically targeting histamine H1 receptors. Histamine H1 receptor agonists are commonly employed for their antiallergic and anti-inflammatory properties. By binding to histamine receptors, these compounds can modulate allergic responses and inflammation. The dihydrochloride salt form enhances the compound’s stability and solubility, making it more suitable for research and pharmaceutical applications. 2-Phenylhistamine dihydrochloride is utilized in various studies and experiments focusing on histamine receptors and related physiological processes.
CAS Number | 51721-62-1 |
Molecular Formula | C11H15Cl2N3 |
Purity | ≥95% |
IUPAC Name | 2-(2-phenyl-1H-imidazol-5-yl)ethanamine;dihydrochloride |
InChI | InChI=1S/C11H13N3.2ClH/c12-7-6-10-8-13-11(14-10)9-4-2-1-3-5-9;;/h1-5,8H,6-7,12H2,(H,13,14);2*1H |
InChIKey | SWIORGCKHSIQHY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC=C(N2)CCN.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |