For research use only. Not for therapeutic Use.
2-(Phenylmethoxy)-4-pyrimidinamine(CAT: L044104) is a high-purity heterocyclic compound widely utilized in pharmaceutical, chemical, and biochemical research. Featuring a phenylmethoxy group and an amino substituent on a pyrimidine core, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, drug candidates, and fine chemicals. Its unique structure makes it particularly valuable in medicinal chemistry for developing therapeutic agents and studying structure-activity relationships. With excellent stability and reactivity, 2-(Phenylmethoxy)-4-pyrimidinamine ensures precision and reliability, making it a critical tool for advanced research and innovative synthetic applications.
CAS Number | 60722-67-0 |
Molecular Formula | C11H11N3O |
Purity | ≥95% |
IUPAC Name | 2-phenylmethoxypyrimidin-4-amine |
InChI | InChI=1S/C11H11N3O/c12-10-6-7-13-11(14-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,13,14) |
InChIKey | WLTMBHWSPFMLHL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=NC=CC(=N2)N |