For research use only. Not for therapeutic Use.
(2-Phenyloxazol-5-yl)methanol(CAT: L030027) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a 2-phenyloxazole core with a hydroxymethyl group at the 5-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules and complex organic compounds. Its unique structure and reactivity make it particularly valuable for medicinal chemistry applications, including the development of drug candidates and enzyme inhibitors. (2-Phenyloxazol-5-yl)methanol ensures reliable performance in experimental setups, supporting innovation in drug discovery, fine chemical production, and advanced organic synthesis.
CAS Number | 238433-75-5 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
IUPAC Name | (2-phenyl-1,3-oxazol-5-yl)methanol |
InChI | InChI=1S/C10H9NO2/c12-7-9-6-11-10(13-9)8-4-2-1-3-5-8/h1-6,12H,7H2 |
InChIKey | IGCIKGHHWZIVOD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC=C(O2)CO |