For research use only. Not for therapeutic Use.
2-Phenylpyridin-3-ol（Cat No.:L014887）is a heterocyclic compound used in pharmaceutical and chemical research. This molecule features a pyridine ring with a phenyl group attached to the 2-position and a hydroxyl group at the 3-position, making it a versatile intermediate in the synthesis of bioactive compounds. It is often employed in the development of potential therapeutic agents, particularly in the fields of oncology and neurology. The unique combination of the aromatic ring and hydroxyl group allows for diverse chemical modifications, supporting advanced research in medicinal chemistry and drug discovery.
| Catalog Number | L014887 |
| CAS Number | 3308-02-9 |
| Molecular Formula | C11H9NO |
| Purity | ≥95% |
| IUPAC Name | 2-phenylpyridin-3-ol |
| InChI | InChI=1S/C11H9NO/c13-10-7-4-8-12-11(10)9-5-2-1-3-6-9/h1-8,13H |
| InChIKey | VHRHRMPFHJXSNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)O |
