For research use only. Not for therapeutic Use.
2-(Piperidin-3-yl)pyridine (Cat.No:L034933) is a chemical compound widely employed in medicinal chemistry and drug discovery. Its unique heterocyclic structure containing both pyridine and piperidine rings enhances its biological activity. This compound serves as a valuable intermediate in the synthesis of diverse pharmaceutical and bioactive molecules.
Catalog Number | L034933 |
CAS Number | 40864-10-6 |
Molecular Formula | C10H14N2 |
Purity | ≥95% |
IUPAC Name | 2-piperidin-3-ylpyridine |
InChI | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-2,5,7,9,11H,3-4,6,8H2 |
InChIKey | ZCEKZDKAGHJNRD-UHFFFAOYSA-N |