For research use only. Not for therapeutic Use.
2-(Piperidin-4-yl)pyrimidine hydrochloride is a heterocyclic compound with a pyrimidine core and a piperidine substituent, commonly used in pharmaceutical research and organic synthesis. The hydrochloride form enhances its solubility, making it suitable for various reactions in aqueous conditions. This compound serves as a valuable building block in the development of bioactive molecules, particularly in kinase inhibitor design and receptor modulation studies. Its stability and reactivity support applications in medicinal chemistry, including drug discovery and complex synthetic frameworks.
CAS Number | 690261-64-4 |
Molecular Formula | C9H14ClN3 |
Purity | ≥95% |
IUPAC Name | 2-piperidin-4-ylpyrimidine;hydrochloride |
InChI | InChI=1S/C9H13N3.ClH/c1-4-11-9(12-5-1)8-2-6-10-7-3-8;/h1,4-5,8,10H,2-3,6-7H2;1H |
InChIKey | UHKXHOSBSOOQIF-UHFFFAOYSA-N |
SMILES | C1CNCCC1C2=NC=CC=N2.Cl |