For research use only. Not for therapeutic Use.
2-Piperidinobenzonitrile (Cat No.:L015588) is a chemical compound featuring a piperidine ring connected to a benzene ring through a nitrile (CN) group. This structure combines a six-membered nitrogen-containing ring with a benzene ring, containing the nitrile functional group. It may find applications in organic synthesis and medicinal chemistry as a versatile building block for creating more complex molecules or as a precursor in the synthesis of pharmaceuticals and other biologically active compounds.
Catalog Number | L015588 |
CAS Number | 72752-52-4 |
Molecular Formula | C12H14N2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-piperidin-1-ylbenzonitrile |
InChI | InChI=1S/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
InChIKey | MEBVSLLKZSAIGK-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=CC=CC=C2C#N |