For research use only. Not for therapeutic Use.
2-Propylaniline (Cat No.:M122409) is a chemical compound. It consists of an aniline ring substituted with a propyl group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Aniline derivatives serve as building blocks in the preparation of diverse molecules, including pharmaceuticals, agrochemicals, and materials. The presence of a propyl group adds structural diversity and reactivity to the compound. 2-Propylaniline’s role as a synthetic intermediate contributes to the construction of complex structures for applications in drug discovery, materials science, and other chemical industries, supporting the advancement of synthetic chemistry and research.
CAS Number | 1821-39-2 |
Molecular Formula | C9H13N |
Purity | ≥95% |
Storage | Keep in dark place,Inert atmosphere,Room temperature |
IUPAC Name | 2-propylaniline |
InChI | InChI=1S/C9H13N/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7H,2,5,10H2,1H3 |
InChIKey | WKURVXXDGMYSDP-UHFFFAOYSA-N |
SMILES | CCCC1=CC=CC=C1N |