For research use only. Not for therapeutic Use.
2-(Pyridin-3-yl)cyclopropane-1-carboxylic acid(CAT: L018591) is a high-purity organic compound featuring a cyclopropane ring linked to a pyridine moiety and a carboxylic acid group. This unique structure makes it a valuable intermediate in pharmaceutical and chemical research, particularly in the synthesis of bioactive molecules and drug discovery. Its well-defined properties support the development of novel therapeutic agents and advanced materials. With reliable quality and exceptional stability, 2-(Pyridin-3-yl)cyclopropane-1-carboxylic acid is a versatile building block for exploring innovative applications in medicinal chemistry and organic synthesis.
CAS Number | 1017553-74-0 |
Molecular Formula | C9H9NO2 |
Purity | ≥95% |
IUPAC Name | 2-pyridin-3-ylcyclopropane-1-carboxylic acid |
InChI | InChI=1S/C9H9NO2/c11-9(12)8-4-7(8)6-2-1-3-10-5-6/h1-3,5,7-8H,4H2,(H,11,12) |
InChIKey | RMVMPLYFCJXMCQ-UHFFFAOYSA-N |
SMILES | C1C(C1C(=O)O)C2=CN=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |