For research use only. Not for therapeutic Use.
2-(Pyridin-3-ylmethoxy)isoindoline-1,3-dione is an isoindoline-based compound with a pyridylmethoxy group attached to the 2-position. Known for its bioactivity, this molecule is frequently used in medicinal and pharmaceutical research, particularly in synthesizing bioactive compounds with potential therapeutic applications. The structure, combining isoindoline-1,3-dione with a pyridine ring, provides sites for selective modifications, enhancing its versatility. Its stability and functionality make it valuable in developing drugs and studying molecular interactions in medicinal chemistry.
Catalog Number | L002639 |
CAS Number | 30777-95-8 |
Molecular Formula | C14H10N2O3 |
Purity | ≥95% |
IUPAC Name | 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione |
InChI | InChI=1S/C14H10N2O3/c17-13-11-5-1-2-6-12(11)14(18)16(13)19-9-10-4-3-7-15-8-10/h1-8H,9H2 |
InChIKey | PLNOXXFMIVONEL-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC3=CN=CC=C3 |